AA21071
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $22.00 | $16.00 | - + | |
25g | 98% | in stock | $42.00 | $30.00 | - + | |
100g | 98% | in stock | $83.00 | $59.00 | - + | |
250g | ≥ 99% (Assay) | in stock | $162.00 | $113.00 | - + | |
500g | 98% | in stock | $306.00 | $214.00 | - + | |
1kg | ≥ 99% (Assay) | in stock | $445.00 | $312.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21071 |
Chemical Name: | Z-Asp-OH |
CAS Number: | 1152-61-0 |
Molecular Formula: | C12H13NO6 |
Molecular Weight: | 267.2347 |
MDL Number: | MFCD00002719 |
SMILES: | O=C(N[C@H](C(=O)O)CC(=O)O)OCc1ccccc1 |
Complexity: | 337 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 0.6 |
Sensors (Basel, Switzerland) 20110101
Bioorganic & medicinal chemistry letters 20100901
Analytical chemistry 20090301
Nature chemical biology 20090101
Biotechnology progress 20070101
American journal of respiratory cell and molecular biology 20060301
Macromolecular bioscience 20050714
Archives of pharmacal research 20040301
Biochemical pharmacology 19991015