logo
Home  > Fmoc-adma(pbf)-oh

AI11909

1185841-84-2 | Fmoc-adma(pbf)-oh

Packsize Purity Availability Price Discounted Price    Quantity
25mg 99% in stock $169.00 $118.00 -   +
100mg 99% in stock $283.00 $198.00 -   +
250mg 99% in stock $469.00 $328.00 -   +
1g 99% in stock $933.00 $653.00 -   +
5g 99% in stock $4,019.00 $2,813.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI11909
Chemical Name: Fmoc-adma(pbf)-oh
CAS Number: 1185841-84-2
Molecular Formula: C36H44N4O7S
Molecular Weight: 676.8221600000002
MDL Number: MFCD15141977
SMILES: O=C(N[C@H](C(=O)O)CCC/N=C(\N(C)C)/NS(=O)(=O)c1c(C)c(C)c2c(c1C)CC(O2)(C)C)OCC1c2ccccc2-c2c1cccc2

 

Upstream Synthesis Route
  • The Fmoc-L-Arg(Me)2(Pbf)-OH amino acid derivative is a versatile compound commonly used in chemical synthesis, specifically in peptide synthesis. It serves as a building block for constructing peptides with arginine residues, imparting unique properties and functionality to the synthesized peptides. This derivative provides a protected form of arginine that allows for controlled and selective deprotection during the synthesis process, ensuring the desired amino acid sequences are accurately incorporated. The Fmoc-L-Arg(Me)2(Pbf)-OH derivative plays a crucial role in the efficient assembly of complex peptide structures in a controlled manner, making it an essential tool in peptide chemistry and drug development research.
FEATURED PRODUCTS