AH51172
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $13.00 | $9.00 | - + | |
5mg | 98% | in stock | $31.00 | $22.00 | - + | |
10mg | 98% | in stock | $45.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH51172 |
Chemical Name: | Ponesimod |
CAS Number: | 854107-55-4 |
Molecular Formula: | C23H25ClN2O4S |
Molecular Weight: | 460.9736 |
MDL Number: | MFCD18207776 |
SMILES: | CCCN=C1S/C(=C\c2ccc(c(c2)Cl)OC[C@@H](CO)O)/C(=O)N1c1ccccc1C |
Complexity: | 674 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.6 |
BMJ (Clinical research ed.) 20160822
Bioorganic & medicinal chemistry letters 20131201
The Journal of pharmacology and experimental therapeutics 20110501
Journal of medicinal chemistry 20100527