AA00035
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 90% | in stock | $73.00 | $51.00 | - + | |
250mg | 90% | in stock | $137.00 | $96.00 | - + | |
1g | 90% | in stock | $153.00 | $107.00 | - + | |
5g | 90% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00035 |
Chemical Name: | 4-{[5-(4-carbamimidoylphenoxy)pentyl]oxy}benzene-1-carboximidamide |
CAS Number: | 100-33-4 |
Molecular Formula: | C19H24N4O2 |
Molecular Weight: | 340.4195 |
MDL Number: | MFCD00599574 |
SMILES: | NC(=N)c1ccc(cc1)OCCCCCOc1ccc(cc1)C(=N)N |
4,4'-(Pentamethylenedioxy)dibenzamidine is a versatile compound widely utilized in chemical synthesis as a robust building block for the creation of various complex molecules. Due to its unique structure and reactivity, this compound serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its strategic incorporation in synthesis pathways allows for efficient construction of diverse organic frameworks with high precision and yield. Additionally, the presence of the pentamethylenedioxy group provides enhanced stability and functionality, enabling controlled and selective reactions to take place. In summary, the utilization of 4,4'-(Pentamethylenedioxy)dibenzamidine in chemical synthesis offers chemists a powerful tool to facilitate the synthesis of valuable compounds across multiple industries.