logo
Home  > AmpicillinAmino-benzeneacetaldehyde

AX31676

10001-82-8 | AmpicillinAmino-benzeneacetaldehyde

Packsize Purity Availability Price Discounted Price    Quantity
5mg 3 weeks $358.00 $251.00 -   +
25mg 3 weeks $795.00 $556.00 -   +
100mg 3 weeks $1,914.00 $1,340.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX31676
Chemical Name: AmpicillinAmino-benzeneacetaldehyde
CAS Number: 10001-82-8
Molecular Formula: C24H26N4O5S
Molecular Weight: 482.552
MDL Number: MFCD11109422
SMILES: O=C([C@@H](c1ccccc1)NC(=O)[C@@H](c1ccccc1)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C

 

Upstream Synthesis Route
  • Ampicillin Amino-benzeneacetaldehyde is a versatile compound that finds considerable application in chemical synthesis. Known for its ability to serve as a key building block in the creation of various pharmaceuticals and fine chemicals, this compound is highly regarded for its role in the synthesis of ampicillin, a widely used antibiotic.In the realm of chemical synthesis, Ampicillin Amino-benzeneacetaldehyde plays a crucial role as a precursor in the production of ampicillin, a penicillin-type antibiotic that is effective against a broad spectrum of bacteria. By undergoing specific chemical reactions and transformations, Ampicillin Amino-benzeneacetaldehyde can be manipulated to yield the valuable ampicillin molecule, which possesses potent antibacterial properties.Moreover, this compound is also utilized in the synthesis of other pharmaceutical agents and bioactive molecules due to its structural significance and reactivity. Its molecular structure and functional groups make it a valuable starting material for the construction of complex organic molecules through various synthetic pathways and processes.In summary, Ampicillin Amino-benzeneacetaldehyde stands as a critical ingredient in the realm of chemical synthesis, particularly in the production of pharmaceuticals, where its unique properties and versatile nature make it a valuable asset in the creation of essential drugs and bioactive compounds.
FEATURED PRODUCTS