AA00245
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $65.00 | $45.00 | - + | |
5g | 97% | in stock | $201.00 | $141.00 | - + | |
25g | 97% | in stock | $463.00 | $324.00 | - + | |
100g | 97% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00245 |
Chemical Name: | 5-Bromo-N-cyclopropyl-2-methoxybenzenesulfonamide |
CAS Number: | 1000339-35-4 |
Molecular Formula: | C10H12BrNO3S |
Molecular Weight: | 306.1762 |
MDL Number: | MFCD08235093 |
SMILES: | COc1ccc(cc1S(=O)(=O)NC1CC1)Br |
Complexity: | 337 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.1 |
5-bromo-N-cyclopropyl-2-methoxybenzenesulfonamide is a versatile compound widely utilized in chemical synthesis due to its unique properties. This compound serves as an essential building block in the preparation of various pharmaceuticals, agrochemicals, and other organic compounds. In the realm of chemical synthesis, this compound is valued for its ability to introduce the 5-bromo substituent, the N-cyclopropyl group, and the 2-methoxybenzenesulfonyl moiety into target molecules with precision and efficiency. These functional groups play crucial roles in modulating the biological activity, stability, and pharmacokinetic properties of the synthesized molecules. Additionally, the presence of the sulfonamide group provides opportunities for further derivatization, enabling the synthesis of more complex and diverse chemical entities. In summary, the strategic incorporation of 5-bromo-N-cyclopropyl-2-methoxybenzenesulfonamide in chemical synthesis facilitates the construction of novel compounds with potential applications in medicine, agriculture, and materials science.