1000340-27-1 | 6-Methyl-1h-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	1 week	$99.00	$69.00
250mg	95%	1 week	$166.00	$116.00
1g	95%	1 week	$445.00	$312.00

Description

• Catalog Number: AA00311
• Chemical Name: 6-Methyl-1h-pyrrolo[2,3-b]pyridine-3-carboxylic acid
• CAS Number: 1000340-27-1
• Molecular Formula: C9H8N2O2
• Molecular Weight: 176.172
• MDL Number: MFCD09880115
• SMILES: Cc1ccc2c(n1)[nH]cc2C(=O)O

Upstream Synthesis Route

6-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid, also known as $name$, is a versatile chemical compound that finds widespread use in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structure and reactivity.In chemical synthesis, $name$ is often employed as a precursor for the synthesis of complex molecules. Its functional groups provide valuable sites for introducing additional substituents and modifying the compound to generate new derivatives with enhanced properties. By incorporating $name$ into a synthetic route, chemists can access a diverse array of compounds with different biological activities or physical characteristics.Moreover, the presence of the pyrrolo-pyridine scaffold in $name$ offers opportunities for diversification through various chemical transformations, such as functional group interconversions, cross-coupling reactions, or cyclization reactions. These synthetic strategies enable the efficient construction of molecular libraries for drug discovery, material science, or other applications requiring tailored chemical structures.Overall, 6-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid plays a crucial role in chemical synthesis by serving as a versatile intermediate for the creation of advanced organic compounds with potential applications in various industries.