AA00412
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $7.00 | $5.00 | - + | |
250mg | 98% | in stock | $12.00 | $9.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00412 |
Chemical Name: | 3-Iodo-6-(trifluoromethyl)-1h-indazole |
CAS Number: | 1000341-27-4 |
Molecular Formula: | C8H4F3IN2 |
Molecular Weight: | 312.0304 |
MDL Number: | MFCD09263230 |
SMILES: | Ic1n[nH]c2c1ccc(c2)C(F)(F)F |
3-Iodo-6-(trifluoromethyl)-1H-indazole, also known as $name$, is a versatile chemical compound that finds crucial applications in chemical synthesis. It serves as a valuable building block in the creation of organic molecules with enhanced properties and functionalities. In the realm of chemical synthesis, $name$ acts as a key intermediate in the production of various pharmaceuticals, agrochemicals, and materials.$name$ is particularly valued for its ability to participate in diverse reactions, such as nucleophilic substitution, palladium-catalyzed coupling, and radical chemistry. These reactions enable the attachment of different functional groups to the indazole core, allowing for the synthesis of novel molecules with tailored properties. Additionally, the presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the resulting compounds, making them potential candidates for drug development and other applications.Furthermore, the strategic placement of the iodine atom in $name$ confers it with unique reactivity that can be exploited for further derivatization. This characteristic makes it a sought-after reagent in the synthesis of complex organic molecules, where precise control over the substitution pattern is required. Overall, the versatility and reactivity of $name$ make it an indispensable tool for chemists engaged in the design and synthesis of innovative compounds for various industrial and research purposes.