1000342-77-7 | 6-Nitro-5-azaindole

Availability
Typically In Stock

Description

• Catalog Number: AA00529
• Chemical Name: 6-Nitro-5-azaindole
• CAS Number: 1000342-77-7
• Molecular Formula: C7H5N3O2
• Molecular Weight: 163.1335
• MDL Number: MFCD08690137
• SMILES: [O-][N+](=O)c1ncc2c(c1)[nH]cc2

Upstream Synthesis Route

6-Nitro-1H-pyrrolo[3,2-c]pyridine is a versatile compound widely utilized in chemical synthesis for its unique structural properties and reactivity. As a nitro-substituted heterocycle, this compound serves as a valuable building block for the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its presence in the molecular structure imparts distinct characteristics that play a crucial role in the development of novel organic compounds.In organic synthesis, 6-Nitro-1H-pyrrolo[3,2-c]pyridine can undergo a range of transformations, such as reduction, substitution, and functional group interconversions, which enable the formation of intricate molecular architectures with tailored properties. Its ability to participate in diverse chemical reactions makes it a valuable intermediate in the construction of heterocyclic scaffolds, which are prevalent in drug discovery and material science.Moreover, the nitro group in 6-Nitro-1H-pyrrolo[3,2-c]pyridine can serve as a handle for further derivatization, allowing for the introduction of various functional groups to modulate the compound's physicochemical properties. This flexibility in modification makes it a key component in the development of potential drug candidates and advanced materials with targeted applications.Overall, the strategic use of 6-Nitro-1H-pyrrolo[3,2-c]pyridine in chemical synthesis enables the synthesis of structurally diverse molecules with enhanced properties, making it an indispensable tool for organic chemists in the design and creation of complex compounds for various industrial sectors.