AA00741
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $75.00 | $52.00 | - + | |
1g | 97% | in stock | $158.00 | $110.00 | - + | |
5g | 97% | in stock | $438.00 | $306.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00741 |
Chemical Name: | 4-Methoxy-3-(trifluoromethyl)phenylacetic acid |
CAS Number: | 1000566-45-9 |
Molecular Formula: | C10H9F3O3 |
Molecular Weight: | 234.1719 |
MDL Number: | MFCD09832302 |
SMILES: | COc1ccc(cc1C(F)(F)F)CC(=O)O |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.2 |
The 2-(4-Methoxy-3-(trifluoromethyl)phenyl)acetic acid plays a crucial role in chemical synthesis as a versatile building block. It exhibits unique properties that make it highly desirable for various synthetic applications. The presence of the methoxy and trifluoromethyl groups imparts distinct reactivity, allowing for strategic incorporation into complex molecular structures. In organic synthesis, this compound serves as a valuable starting material for the preparation of pharmaceuticals, agrochemicals, and advanced materials. Its functional groups can participate in a range of transformations such as Suzuki coupling, esterification, amidation, and oxidation reactions. Additionally, the trifluoromethyl moiety enhances the compound's lipophilicity, potentially influencing its bioavailability and pharmacological properties. This compound's synthetic utility extends to the construction of heterocycles, organometallic complexes, and chiral compounds. Overall, the 2-(4-Methoxy-3-(trifluoromethyl)phenyl)acetic acid is a valuable tool for chemists seeking to design and construct novel molecules with specific properties and functionalities.