AA00773
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $56.00 | $40.00 | - + | |
1g | 98% | in stock | $97.00 | $68.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00773 |
Chemical Name: | Methyl 3-cyanoindole-6-carboxylate |
CAS Number: | 1000576-51-1 |
Molecular Formula: | C11H8N2O2 |
Molecular Weight: | 200.1934 |
MDL Number: | MFCD09878564 |
SMILES: | COC(=O)c1ccc2c(c1)[nH]cc2C#N |
Complexity: | 307 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
Methyl 3-cyano-1H-indole-6-carboxylate is a versatile compound widely used in chemical synthesis for the preparation of various organic molecules. Its functionality as a key intermediate makes it valuable in the formation of complex structures, particularly in pharmaceutical and agrochemical industries. By serving as a precursor in the synthesis of biologically active compounds, this compound enables the creation of diverse molecular entities with potentially beneficial properties. Furthermore, its reactivity allows for the modification and functionalization of organic frameworks, making it an essential building block in the design and production of novel molecules with tailored properties for specific applications.