logo
Home  > Methyl 3-amino-5-phenylthiophene-2-carboxylate

AA00855

100063-22-7 | Methyl 3-amino-5-phenylthiophene-2-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $23.00 $16.00 -   +
5g 98% in stock $38.00 $26.00 -   +
25g 98% in stock $162.00 $113.00 -   +
100g 98% in stock $506.00 $354.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA00855
Chemical Name: Methyl 3-amino-5-phenylthiophene-2-carboxylate
CAS Number: 100063-22-7
Molecular Formula: C12H11NO2S
Molecular Weight: 233.2862
MDL Number: MFCD00068161
SMILES: COC(=O)c1sc(cc1N)c1ccccc1

 

Computed Properties
Complexity: 253  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 3  
XLogP3: 3.3  

 

 

Upstream Synthesis Route
  • Methyl 3-amino-5-phenylthiophene-2-carboxylate is a versatile compound used in chemical synthesis as a key intermediate for the preparation of various pharmaceuticals, agrochemicals, and organic materials. This compound plays a crucial role in the construction of complex molecular structures due to its unique chemical properties and reactivity.In organic synthesis, Methyl 3-amino-5-phenylthiophene-2-carboxylate serves as a valuable building block for the creation of heterocyclic compounds and organic molecules with diverse functionalities. It can undergo various chemical reactions such as substitution, addition, and coupling reactions to generate a wide range of final products. Additionally, its presence in a chemical reaction can facilitate the formation of new carbon-carbon or carbon-heteroatom bonds, enabling the synthesis of intricate molecular architectures.Furthermore, the functional groups present in Methyl 3-amino-5-phenylthiophene-2-carboxylate can be modified or protected to control its chemical reactivity and selectivity during the synthesis process. This compound acts as a key precursor in the development of biologically active compounds, making it a valuable tool in medicinal chemistry and drug discovery research.Overall, Methyl 3-amino-5-phenylthiophene-2-carboxylate is a fundamental component in the toolbox of synthetic chemists for designing and constructing new molecules with diverse applications in the fields of pharmaceuticals, materials science, and agrochemicals.
FEATURED PRODUCTS