AA00881
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $76.00 | $53.00 | - + | |
5g | 96% | in stock | $288.00 | $201.00 | - + | |
10g | 96% | in stock | $459.00 | $321.00 | - + | |
25g | 96% | in stock | $916.00 | $641.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00881 |
Chemical Name: | 2-(Tributylstannyl)propene |
CAS Number: | 100073-15-2 |
Molecular Formula: | C15H32Sn |
Molecular Weight: | 331.1156 |
MDL Number: | MFCD10699166 |
SMILES: | CCCC[Sn](C(=C)C)(CCCC)CCCC |
Complexity: | 162 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Rotatable Bond Count: | 10 |
Tributyl(prop-1-en-2-yl)stannane, also known as Bu3SnCH2CHCH2, is a versatile organotin compound commonly used in chemical synthesis. Due to its unique structure and reactivity, this compound plays a crucial role in various organic reactions, particularly in the field of organic chemistry.One of the key applications of Tributyl(prop-1-en-2-yl)stannane is its use as a reagent in catalytic processes, such as cross-coupling reactions. By serving as a source of prop-1-en-2-yl radical, this compound facilitates the formation of new carbon-carbon bonds, enabling the synthesis of complex organic molecules with high efficiency and selectivity.Additionally, Tributyl(prop-1-en-2-yl)stannane is frequently employed in radical-mediated transformations, where the prop-1-en-2-yl radical acts as a versatile intermediate for the generation of various functional groups. This reactivity makes the compound valuable in the construction of diverse organic frameworks and the modification of existing molecular structures.Furthermore, the presence of a tin atom in Tributyl(prop-1-en-2-yl)stannane confers unique properties that can enhance the stereochemical control of certain reactions. Its coordination with other reagents or substrates can lead to regioselective or stereoselective outcomes, making it a valuable tool for the strategic design of organic synthesis strategies.In conclusion, Tributyl(prop-1-en-2-yl)stannane stands as a valuable reagent in chemical synthesis, offering a versatile platform for the construction of complex organic molecules through its unique radical-based reactivity and coordination properties. Its application in various catalytic and radical-mediated processes highlights its significance in modern organic chemistry research and development.