AA00930
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $23.00 | $17.00 | - + | |
250mg | 97% | in stock | $28.00 | $20.00 | - + | |
1g | 97% | in stock | $87.00 | $61.00 | - + | |
5g | 97% | in stock | $176.00 | $124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00930 |
Chemical Name: | 1-Cyclopropylmethyl-1H-pyrazole-4-boronic acid, pinacol ester |
CAS Number: | 1000801-75-1 |
Molecular Formula: | C13H21BN2O2 |
Molecular Weight: | 248.129 |
MDL Number: | MFCD15474887 |
SMILES: | CC1(C)OB(OC1(C)C)c1cnn(c1)CC1CC1 |
Complexity: | 315 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
1-(Cyclopropylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a versatile compound widely used in chemical synthesis as a valuable building block for the formation of complex organic molecules. With its unique chemical structure, this compound serves as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals.In organic synthesis, 1-(Cyclopropylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole plays a crucial role as a masked pyrazole synthon, enabling chemists to introduce the pyrazole moiety selectively under mild reaction conditions. This compound offers a convenient and efficient way to incorporate the pyrazole ring into target molecules, allowing for the efficient construction of diverse chemical structures.Furthermore, the Cyclopropylmethyl group in this compound serves as a valuable protecting group, facilitating controlled functional group manipulations during the synthesis of complex organic compounds. By strategically incorporating and removing this protective group, chemists can achieve precise and selective transformations, ultimately leading to the synthesis of desired products with high yields and purity.Overall, the application of 1-(Cyclopropylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole in chemical synthesis offers a powerful tool for the construction of diverse organic molecules with applications spanning the pharmaceutical, agricultural, and material science industries.