AA00925
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $37.00 | $26.00 | - + | |
250mg | 95% | in stock | $60.00 | $42.00 | - + | |
1g | 95% | in stock | $172.00 | $121.00 | - + | |
5g | 95% | in stock | $758.00 | $531.00 | - + | |
10g | 95% | in stock | $1,131.00 | $792.00 | - + | |
25g | 95% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00925 |
Chemical Name: | 1-(2-(Pyrrolidin-1-yl)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
CAS Number: | 1000802-52-7 |
Molecular Formula: | C15H26BN3O2 |
Molecular Weight: | 291.1968 |
MDL Number: | MFCD16659795 |
SMILES: | CC1(C)OB(OC1(C)C)c1cnn(c1)CCN1CCCC1 |
Complexity: | 356 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
The compound 1-(2-(Pyrrolidin-1-yl)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole has found significant utility in chemical synthesis as a versatile building block. It serves as a key intermediate in the construction of various organic molecules, particularly in the formation of complex heterocycles and functionalized compounds. This compound's unique structural features enable it to participate in diverse synthetic transformations, facilitating the creation of novel chemical entities with potential applications in pharmaceuticals, materials science, and agrochemicals. Its strategic incorporation in multi-step synthesis allows for the efficient assembly of molecular scaffolds with specific properties, making it a valuable tool for organic chemists seeking to design and access structurally diverse compounds for various purposes.