logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyrazoles  > (5-Nitro-1h-pyrazol-3-yl)methanol

AA00912

1000895-25-9 | (5-Nitro-1h-pyrazol-3-yl)methanol

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $82.00 $57.00 -   +
250mg 97% in stock $138.00 $96.00 -   +
1g 97% in stock $405.00 $283.00 -   +
5g 97% in stock $1,302.00 $911.00 -   +
10g 97% in stock $1,856.00 $1,299.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA00912
Chemical Name: (5-Nitro-1h-pyrazol-3-yl)methanol
CAS Number: 1000895-25-9
Molecular Formula: C4H5N3O3
Molecular Weight: 143.1008
MDL Number: MFCD12025912
SMILES: OCc1n[nH]c(c1)[N+](=O)[O-]

 

Computed Properties
Complexity: 134  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 10  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 1  
XLogP3: -0.5  

 

 

Upstream Synthesis Route
  • The compound $name$ is a versatile intermediate that finds application in various organic chemical syntheses. $name$ can serve as a key building block for the synthesis of a wide range of compounds due to its unique chemical properties.When used in chemical synthesis, $name$ can undergo various reactions to introduce different functional groups or modify its structure. For example, $name$ can participate in nucleophilic substitution reactions, oxidation reactions, or even cyclization reactions to form complex molecular structures. Additionally, the presence of the nitro group in $name$ can act as a directing group in certain reactions, allowing for selective functionalization at specific positions within the molecule. This property makes $name$ a valuable tool for chemists looking to design novel molecules or fine-tune the reactivity of a particular chemical system.Overall, the versatility of $name$ makes it a valuable reagent in organic synthesis, offering chemists a pathway to access a diverse array of compounds with potential applications in pharmaceuticals, materials science, and other fields.
FEATURED PRODUCTS