AA00912
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $82.00 | $57.00 | - + | |
250mg | 97% | in stock | $138.00 | $96.00 | - + | |
1g | 97% | in stock | $405.00 | $283.00 | - + | |
5g | 97% | in stock | $1,302.00 | $911.00 | - + | |
10g | 97% | in stock | $1,856.00 | $1,299.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00912 |
Chemical Name: | (5-Nitro-1h-pyrazol-3-yl)methanol |
CAS Number: | 1000895-25-9 |
Molecular Formula: | C4H5N3O3 |
Molecular Weight: | 143.1008 |
MDL Number: | MFCD12025912 |
SMILES: | OCc1n[nH]c(c1)[N+](=O)[O-] |
Complexity: | 134 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -0.5 |
The compound $name$ is a versatile intermediate that finds application in various organic chemical syntheses. $name$ can serve as a key building block for the synthesis of a wide range of compounds due to its unique chemical properties.When used in chemical synthesis, $name$ can undergo various reactions to introduce different functional groups or modify its structure. For example, $name$ can participate in nucleophilic substitution reactions, oxidation reactions, or even cyclization reactions to form complex molecular structures. Additionally, the presence of the nitro group in $name$ can act as a directing group in certain reactions, allowing for selective functionalization at specific positions within the molecule. This property makes $name$ a valuable tool for chemists looking to design novel molecules or fine-tune the reactivity of a particular chemical system.Overall, the versatility of $name$ makes it a valuable reagent in organic synthesis, offering chemists a pathway to access a diverse array of compounds with potential applications in pharmaceuticals, materials science, and other fields.