AA00957
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $41.00 | $29.00 | - + | |
25g | 98% | in stock | $137.00 | $96.00 | - + | |
100g | 98% | in stock | $386.00 | $270.00 | - + | |
500g | 98% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00957 |
Chemical Name: | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid |
CAS Number: | 10009-25-3 |
Molecular Formula: | C9H6F4O3 |
Molecular Weight: | 238.1358 |
MDL Number: | MFCD00155926 |
SMILES: | FC(C(Oc1ccc(cc1)C(=O)O)(F)F)F |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3 |
4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid is a key compound utilized in various chemical synthesis processes, particularly in the pharmaceutical and agrochemical industries. This versatile compound serves as a crucial building block in the creation of novel drug molecules and pesticide formulations. Its unique structure and properties make it an essential component in the development of potent and effective active ingredients. Additionally, 4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid plays a pivotal role in the synthesis of specialized materials such as polymers and advanced organic compounds. Its application in chemical synthesis enables researchers and chemists to design and produce a wide range of innovative products with enhanced functionalities and performance characteristics.