AA00960
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $43.00 | $30.00 | - + | |
250mg | 95% | in stock | $68.00 | $47.00 | - + | |
1g | 95% | in stock | $109.00 | $76.00 | - + | |
5g | 95% | in stock | $411.00 | $288.00 | - + | |
10g | 95% | in stock | $797.00 | $558.00 | - + | |
25g | 95% | in stock | $1,835.00 | $1,285.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA00960 |
Chemical Name: | 2-(Boc-amino)-6-hydroxyspiro[3.3]heptane |
CAS Number: | 1000933-99-2 |
Molecular Formula: | C12H21NO3 |
Molecular Weight: | 227.3 |
MDL Number: | MFCD09702342 |
SMILES: | OC1CC2(C1)CC(C2)NC(=O)OC(C)(C)C |
Complexity: | 281 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.5 |
The tert-Butyl (6-hydroxyspiro[3.3]heptan-2-yl)carbamate, also known as $name$, is a versatile compound widely utilized in chemical synthesis processes. Its unique structure and properties make it an essential component in various reactions and transformations.In chemical synthesis, $name$ serves as a valuable protecting group for amino groups. By selectively masking the amino functionality with $name$, chemists can control the reactivity of the amine and direct the course of reactions towards specific desired products. This protection strategy enables the synthesis of complex molecules with multiple amine groups by allowing selective functionalization at specific sites while keeping other amines inert.Furthermore, the presence of the tert-butyl moiety in $name$ provides steric hindrance, which can significantly impact the reactivity and selectivity of reactions. This steric bulk can influence the orientation of approaching reagents or catalysts, leading to regioselective or stereoselective outcomes in chemical transformations.Overall, the application of tert-Butyl (6-hydroxyspiro[3.3]heptan-2-yl)carbamate in chemical synthesis plays a crucial role in enabling efficient and controlled synthesis of intricate molecules with specific functionalities, demonstrating its significance in modern organic chemistry practices.