AA01002
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $13.00 | $9.00 | - + | |
25g | 95% | in stock | $35.00 | $24.00 | - + | |
100g | 95% | in stock | $93.00 | $65.00 | - + | |
500g | 95% | in stock | $460.00 | $322.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA01002 |
Chemical Name: | D-Glutamic acid diethyl ester hydrochloride |
CAS Number: | 1001-19-0 |
Molecular Formula: | C9H18ClNO4 |
Molecular Weight: | 239.69652000000002 |
MDL Number: | MFCD11111544 |
SMILES: | CCOC(=O)CC[C@H](C(=O)OCC)N.Cl |
Complexity: | 193 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
(R)-Diethyl 2-aminopentanedioate hydrochloride is a key compound commonly used in chemical synthesis for its versatile applications. This compound serves as a valuable building block in the construction of various molecules, particularly in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical reactions, (R)-Diethyl 2-aminopentanedioate hydrochloride acts as a crucial intermediate, enabling the formation of complex structures with high stereochemical purity. Its unique properties make it a preferred reagent in asymmetric synthesis, where control over chirality is essential for obtaining desired enantiomeric products. Additionally, (R)-Diethyl 2-aminopentanedioate hydrochloride can be employed in the preparation of chiral ligands and catalysts, further expanding its utility in organic chemistry. This compound's role in chemical synthesis underscores its significance in advancing scientific research and innovation across various industries.