logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > D-Glutamic acid diethyl ester hydrochloride

AA01002

1001-19-0 | D-Glutamic acid diethyl ester hydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
5g 95% in stock $13.00 $9.00 -   +
25g 95% in stock $35.00 $24.00 -   +
100g 95% in stock $93.00 $65.00 -   +
500g 95% in stock $460.00 $322.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA01002
Chemical Name: D-Glutamic acid diethyl ester hydrochloride
CAS Number: 1001-19-0
Molecular Formula: C9H18ClNO4
Molecular Weight: 239.69652000000002
MDL Number: MFCD11111544
SMILES: CCOC(=O)CC[C@H](C(=O)OCC)N.Cl

 

Computed Properties
Complexity: 193  
Covalently-Bonded Unit Count: 2  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 8  

 

 

Upstream Synthesis Route
  • (R)-Diethyl 2-aminopentanedioate hydrochloride is a key compound commonly used in chemical synthesis for its versatile applications. This compound serves as a valuable building block in the construction of various molecules, particularly in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical reactions, (R)-Diethyl 2-aminopentanedioate hydrochloride acts as a crucial intermediate, enabling the formation of complex structures with high stereochemical purity. Its unique properties make it a preferred reagent in asymmetric synthesis, where control over chirality is essential for obtaining desired enantiomeric products. Additionally, (R)-Diethyl 2-aminopentanedioate hydrochloride can be employed in the preparation of chiral ligands and catalysts, further expanding its utility in organic chemistry. This compound's role in chemical synthesis underscores its significance in advancing scientific research and innovation across various industries.
FEATURED PRODUCTS