AE11157
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $57.00 | $40.00 | - + | |
5mg | 98% | in stock | $144.00 | $101.00 | - + | |
10mg | 98% | in stock | $227.00 | $159.00 | - + | |
25mg | 98% | in stock | $350.00 | $245.00 | - + | |
50mg | 98% | in stock | $595.00 | $416.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11157 |
Chemical Name: | BMS-754807 |
CAS Number: | 1001350-96-4 |
Molecular Formula: | C23H24FN9O |
Molecular Weight: | 461.4948 |
MDL Number: | MFCD18633202 |
SMILES: | Fc1ccc(cn1)NC(=O)[C@]1(C)CCCN1c1nc(Nc2n[nH]c(c2)C2CC2)c2n(n1)ccc2 |
Complexity: | 756 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.9 |
BMS-754807, a potent small molecule inhibitor, is widely utilized in chemical synthesis as a crucial tool for the modulation of various biological processes. Its ability to selectively target specific protein kinases makes it a valuable asset in designing and developing new compounds for pharmaceutical purposes. In chemical synthesis, BMS-754807 is instrumental in enabling researchers to manipulate signaling pathways and study the intricate mechanisms underlying cellular functions. By incorporating BMS-754807 into reaction mixtures, chemists can facilitate the production of novel compounds with enhanced properties, paving the way for innovative drug discovery and development.
Cancer research 20140715
Pancreas 20130401
Experimental hematology 20120901
Cancer research 20111215
Clinical cancer research : an official journal of the American Association for Cancer Research 20110415
Endocrine-related cancer 20100901
Bioorganic & medicinal chemistry letters 20100901
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20100601
Journal of medicinal chemistry 20091210
Molecular cancer therapeutics 20091201