logo
Home  > (3S,4S)-tert-Butyl 3-amino-4-methoxypyrrolidine-1-carboxylate

AE23198

1001635-01-3 | (3S,4S)-tert-Butyl 3-amino-4-methoxypyrrolidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $120.00 $84.00 -   +
250mg 95% in stock $200.00 $140.00 -   +
500mg 95% in stock $336.00 $235.00 -   +
1g 95% in stock $502.00 $352.00 -   +
5g 95% in stock $1,498.00 $1,049.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE23198
Chemical Name: (3S,4S)-tert-Butyl 3-amino-4-methoxypyrrolidine-1-carboxylate
CAS Number: 1001635-01-3
Molecular Formula: C10H20N2O3
Molecular Weight: 216.2774
MDL Number: MFCD09040597
SMILES: CC(C)(C)OC(=O)N1CC(C(C1)OC)N

 

Upstream Synthesis Route 
  • The compound (3S,4S)-tert-butyl 3-amino-4-methoxypyrrolidine-1-carboxylate plays a crucial role in chemical synthesis as a versatile building block. With its unique stereochemistry and functional groups, this compound is widely utilized in the creation of complex organic molecules with specific chirality. Its structural features make it an ideal starting material for the synthesis of various pharmaceuticals, agrochemicals, and advanced materials. In organic synthesis, this compound can serve as a key intermediate in the preparation of biologically active compounds through various transformations such as nucleophilic additions, substitutions, and cyclizations. Its presence in a synthetic route can significantly improve the overall efficiency and selectivity of the reaction, leading to the formation of desired products with high yields and purity.
FEATURED PRODUCTS