logo
Home  > (9-Phenyl-9H-carbazol-2-yl)boronic acid

AA01356

1001911-63-2 | (9-Phenyl-9H-carbazol-2-yl)boronic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $15.00 $10.00 -   +
250mg 98% in stock $16.00 $11.00 -   +
1g 98% in stock $22.00 $15.00 -   +
10g 98% in stock $22.00 $16.00 -   +
25g 98% in stock $51.00 $36.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA01356
Chemical Name: (9-Phenyl-9H-carbazol-2-yl)boronic acid
CAS Number: 1001911-63-2
Molecular Formula: C18H14BNO2
Molecular Weight: 287.1203
MDL Number: MFCD22207050
SMILES: OB(c1ccc2c(c1)n(c1ccccc1)c1c2cccc1)O

 

Upstream Synthesis Route 
  • The (9-Phenyl-9H-carbazol-2-yl)boronic acid is a versatile and valuable compound widely used in chemical synthesis due to its unique properties. As a boronic acid derivative, it serves as a crucial building block in organic chemistry reactions, specifically in the field of Suzuki-Miyaura cross-coupling reactions. This compound is employed as a key component in the synthesis of various biaryl and heteroaryl compounds, which are essential in pharmaceuticals, materials science, and agrochemicals industries. The (9-Phenyl-9H-carbazol-2-yl)boronic acid enables the formation of complex molecular structures with high efficiency and selectivity, making it an indispensable tool for synthetic chemists seeking to develop novel molecules with diverse applications.
FEATURED PRODUCTS