AA01509
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $46.00 | $33.00 | - + | |
10g | 95% | in stock | $90.00 | $63.00 | - + | |
25g | 95% | in stock | $182.00 | $127.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA01509 |
Chemical Name: | tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate |
CAS Number: | 1002355-96-5 |
Molecular Formula: | C12H19NO4 |
Molecular Weight: | 241.2836 |
MDL Number: | MFCD16140210 |
SMILES: | CCOC(=O)C=C1CN(C1)C(=O)OC(C)(C)C |
Complexity: | 333 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 0.8 |
The tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate compound serves as a valuable reagent in chemical synthesis due to its unique structure and versatile reactivity. With its azetidine ring and ester functionality, this compound can participate in a wide range of organic reactions, making it a useful building block for the synthesis of various compounds. In particular, tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate can be employed in the synthesis of heterocyclic compounds, pharmaceutical intermediates, and agrochemicals. Its ability to undergo ring-opening reactions, ester hydrolysis, and cycloaddition reactions makes it a versatile tool for organic chemists looking to create complex molecules with specific functionalities. Additionally, the tert-Butyl group provides steric hindrance, which can influence the regioselectivity and stereochemistry of the reactions it undergoes. Overall, tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate is a valuable compound in organic synthesis, enabling the efficient construction of diverse chemical structures for various applications in the field of chemistry.