logo
Home  > Benzoic acid, 5-(1,1-dimethylethyl)-2-hydroxy-3-methoxy-

BD12573

100245-35-0 | Benzoic acid, 5-(1,1-dimethylethyl)-2-hydroxy-3-methoxy-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: BD12573
Chemical Name: Benzoic acid, 5-(1,1-dimethylethyl)-2-hydroxy-3-methoxy-
CAS Number: 100245-35-0
Molecular Formula: C12H16O4
Molecular Weight: 224.253
SMILES: COc1cc(cc(c1O)C(=O)O)C(C)(C)C

 

Upstream Synthesis Route
  • 5-(1,1-Dimethylethyl)-2-hydroxy-3-methoxybenzoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a crucial building block in organic chemistry, particularly in the formation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and properties make it an essential intermediate in the production of advanced materials and bioactive compounds.In chemical synthesis, $name$ plays a key role in the creation of structurally complex molecules through multistep reactions. It can be utilized as a starting material for the synthesis of diverse derivatives with modified functional groups, enabling the fine-tuning of desired properties such as solubility, stability, and bioavailability. Additionally, the presence of the hydroxy and methoxy groups in $name$ offers opportunities for further derivatization, enhancing its utility in designing novel compounds with tailored characteristics.Furthermore, the incorporation of 5-(1,1-Dimethylethyl)-2-hydroxy-3-methoxybenzoic acid in chemical reactions allows for the preparation of biologically active substances with significant pharmacological or agricultural applications. Its involvement in the synthesis of drug candidates, pesticides, herbicides, and other bioactive molecules highlights its importance in the development of innovative products that contribute to human health and agricultural sustainability.In summary, the application of $name$ in chemical synthesis is pivotal for generating diverse compounds with varied functionalities and applications. Its versatility, reactivity, and versatility make it a valuable component in the toolbox of synthetic chemists striving to create new materials and compounds for a myriad of industrial sectors.
FEATURED PRODUCTS