logo
Home  > Chemistry  > Organic Building Blocks  > Phenols  > 5-Chloro-4-methyl-2-nitrophenol

AA01680

100278-74-8 | 5-Chloro-4-methyl-2-nitrophenol

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $89.00 $62.00 -   +
500mg 95% in stock $173.00 $121.00 -   +
1g 95% in stock $183.00 $128.00 -   +
5g 95% in stock $712.00 $498.00 -   +
10g 95% in stock $1,178.00 $824.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA01680
Chemical Name: 5-Chloro-4-methyl-2-nitrophenol
CAS Number: 100278-74-8
Molecular Formula: C7H6ClNO3
Molecular Weight: 187.58044000000004
MDL Number: MFCD19374209
SMILES: [O-][N+](=O)c1cc(C)c(cc1O)Cl

 

Computed Properties
Complexity: 182  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 12  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
XLogP3: 2.9  

 

 

Upstream Synthesis Route
  • 5-Chloro-4-methyl-2-nitrophenol, also known as $name$, is a versatile compound widely utilized in chemical synthesis processes. This compound plays a crucial role in various reactions due to its unique chemical properties.One of the primary applications of 5-Chloro-4-methyl-2-nitrophenol in chemical synthesis is as a key building block in the production of pharmaceuticals. It serves as a precursor in the synthesis of active pharmaceutical ingredients, where its specific structure and reactivity are essential for the formation of complex molecular structures.Additionally, 5-Chloro-4-methyl-2-nitrophenol is commonly employed in the synthesis of specialty chemicals and agricultural products. Its presence in these reactions enables the formation of specific functional groups and molecular arrangements that are vital for the desired properties of the final products.Moreover, this compound is utilized in the synthesis of dyes and pigments, where its characteristic properties contribute to the vibrancy and stability of the colorants produced. By incorporating 5-Chloro-4-methyl-2-nitrophenol into the synthesis process, chemists can achieve precise control over the color and properties of the final product.Overall, the versatile nature of 5-Chloro-4-methyl-2-nitrophenol makes it an indispensable component in various chemical synthesis applications, ranging from pharmaceuticals to specialty chemicals and dyes. Its unique reactivity and structural features make it a valuable resource for chemists exploring new avenues in organic synthesis.
FEATURED PRODUCTS