AA01822
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $45.00 | $32.00 | - + | |
1g | 95% | in stock | $368.00 | $257.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA01822 |
Chemical Name: | 7-(Trifluoromethyl)-2,3-dihydro-1h-inden-1-one |
CAS Number: | 1003048-68-7 |
Molecular Formula: | C10H7F3O |
Molecular Weight: | 200.15718959999995 |
MDL Number: | MFCD11040251 |
SMILES: | O=C1CCc2c1c(ccc2)C(F)(F)F |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 2.5 |
7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one is a versatile compound widely utilized in chemical synthesis processes. Its unique structure featuring a trifluoromethyl group makes it a valuable building block for the creation of diverse organic molecules with enhanced properties. In the field of medicinal chemistry, this compound is often employed in the development of pharmaceuticals due to its potential for modulating biological activity. Furthermore, 7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one plays a crucial role in material science, serving as a key intermediate for producing advanced materials such as polymers and specialty chemicals. Its structural characteristics make it a powerful tool for researchers and chemists seeking innovative solutions in various industries.