AA01964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $57.00 | $40.00 | - + | |
10g | 95% | in stock | $75.00 | $52.00 | - + | |
25g | 95% | in stock | $179.00 | $125.00 | - + | |
100g | 95% | in stock | $620.00 | $434.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA01964 |
Chemical Name: | 1,3,4,6-Tetra-o-acetyl-2-amino-2-deoxy-beta-d-glucopyranose, HCl |
CAS Number: | 10034-20-5 |
Molecular Formula: | C14H22ClNO9 |
Molecular Weight: | 383.7788 |
MDL Number: | MFCD01075204 |
SMILES: | CC(=O)OC[C@H]1O[C@@H](OC(=O)C)[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)N.Cl |
Complexity: | 507 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
The compound (2S,3R,4R,5S,6R)-6-(Acetoxymethyl)-3-aminotetrahydro-2H-pyran-2,4,5-triyl triacetate hydrochloride plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing multiple functional groups makes it a valuable intermediate in the synthesis of complex molecules such as pharmaceuticals, agrochemicals, and specialty chemicals. This compound can be used to introduce the aminotetrahydro-2H-pyran scaffold into various target molecules, allowing for the modification and fine-tuning of their properties. Additionally, the presence of multiple acetyl groups provides opportunities for further derivatization to tailor the compound for specific applications in drug discovery and materials science. Overall, the (2S,3R,4R,5S,6R)-6-(Acetoxymethyl)-3-aminotetrahydro-2H-pyran-2,4,5-triyl triacetate hydrochloride is a valuable tool in the hands of synthetic chemists for the construction of diverse and intricate molecular structures.