logo
Home  > 21H-Biline-8,12-dipropanoic acid, 3,18-diethenyl-1,19,22,24-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-, dimethyl ester

AA02014

10035-62-8 | 21H-Biline-8,12-dipropanoic acid, 3,18-diethenyl-1,19,22,24-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-, dimethyl ester

Packsize Purity Availability Price Discounted Price    Quantity
10mg in stock $362.00 $253.00 -   +
25mg in stock $602.00 $422.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA02014
Chemical Name: 21H-Biline-8,12-dipropanoic acid, 3,18-diethenyl-1,19,22,24-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-, dimethyl ester
CAS Number: 10035-62-8
Molecular Formula: C35H38N4O6
Molecular Weight: 610.6994
MDL Number: MFCD02093416
SMILES: COC(=O)CCC1=C(C)C(=NC1=Cc1[nH]c(c(c1CCC(=O)OC)C)C=C1NC(=O)C(=C1C=C)C)C=C1NC(=O)C(=C1C)C=C

 

Upstream Synthesis Route
  • Biliverdin dimethyl ester is a compound commonly used in chemical synthesis due to its unique properties and applications. In chemical synthesis, this molecule serves as a versatile building block for creating a variety of organic compounds and materials. Biliverdin dimethyl ester is particularly valued for its role as a precursor in the synthesis of various pharmaceuticals, dyes, and other complex organic molecules. Its ability to undergo selective chemical reactions makes it a valuable tool in the development of new compounds with specific properties. Additionally, this compound can also be employed in the study of reaction mechanisms and as a catalyst in certain chemical transformations. Its versatility and potential applications make Biliverdin dimethyl ester a valuable asset in the field of chemical synthesis.
FEATURED PRODUCTS