AA02014
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | in stock | $362.00 | $253.00 | - + | ||
25mg | in stock | $602.00 | $422.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02014 |
Chemical Name: | 21H-Biline-8,12-dipropanoic acid, 3,18-diethenyl-1,19,22,24-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-, dimethyl ester |
CAS Number: | 10035-62-8 |
Molecular Formula: | C35H38N4O6 |
Molecular Weight: | 610.6994 |
MDL Number: | MFCD02093416 |
SMILES: | COC(=O)CCC1=C(C)C(=NC1=Cc1[nH]c(c(c1CCC(=O)OC)C)C=C1NC(=O)C(=C1C=C)C)C=C1NC(=O)C(=C1C)C=C |
Biliverdin dimethyl ester is a compound commonly used in chemical synthesis due to its unique properties and applications. In chemical synthesis, this molecule serves as a versatile building block for creating a variety of organic compounds and materials. Biliverdin dimethyl ester is particularly valued for its role as a precursor in the synthesis of various pharmaceuticals, dyes, and other complex organic molecules. Its ability to undergo selective chemical reactions makes it a valuable tool in the development of new compounds with specific properties. Additionally, this compound can also be employed in the study of reaction mechanisms and as a catalyst in certain chemical transformations. Its versatility and potential applications make Biliverdin dimethyl ester a valuable asset in the field of chemical synthesis.