logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyridines  > 5-Nitropyridine-2-carbonitrile

AA02058

100367-55-3 | 5-Nitropyridine-2-carbonitrile

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $43.00 $31.00 -   +
5g 95% in stock $158.00 $110.00 -   +
10g 95% in stock $208.00 $145.00 -   +
100g 95% in stock $2,004.00 $1,403.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA02058
Chemical Name: 5-Nitropyridine-2-carbonitrile
CAS Number: 100367-55-3
Molecular Formula: C6H3N3O2
Molecular Weight: 149.1069
MDL Number: MFCD07368184
SMILES: N#Cc1ccc(cn1)[N+](=O)[O-]

 

Computed Properties
Complexity: 202  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 11  
Hydrogen Bond Acceptor Count: 4  
XLogP3: 1.3  

 

 

Upstream Synthesis Route
  • 5-Nitro-2-pyridinecarbonitrile, also known as $name$, is a versatile building block widely used in chemical synthesis. Its unique chemical structure and reactivity make it a valuable intermediate in the preparation of various organic compounds.One of the key applications of 5-Nitro-2-pyridinecarbonitrile is in the synthesis of pharmaceutical compounds. By serving as a starting material, it can undergo a series of chemical reactions to introduce specific functional groups and form complex structures necessary for the development of new drugs. Additionally, its nitro and cyano groups offer opportunities for further derivatization, allowing chemists to tailor its properties for specific applications.Furthermore, 5-Nitro-2-pyridinecarbonitrile plays a crucial role in the preparation of agrochemicals. Its incorporation in the synthesis of pesticide and herbicide formulations enhances their efficacy and selectivity, contributing to sustainable agricultural practices.Moreover, this compound is utilized in the production of dyes and pigments, where its presence imparts specific color properties and stability to the final product. Its ability to participate in various synthetic pathways enables the generation of a wide range of chromophores with unique shades and characteristics.Overall, the versatility and utility of 5-Nitro-2-pyridinecarbonitrile in chemical synthesis make it an indispensable component in the development of diverse compounds with applications in pharmaceuticals, agrochemicals, and materials science.
FEATURED PRODUCTS