logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 2,3-Difluoro-4-bromonitrobenzene

AA02074

1003708-24-4 | 2,3-Difluoro-4-bromonitrobenzene

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $27.00 $19.00 -   +
1g 98% in stock $35.00 $25.00 -   +
5g 98% in stock $110.00 $77.00 -   +
25g 98% in stock $529.00 $370.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA02074
Chemical Name: 2,3-Difluoro-4-bromonitrobenzene
CAS Number: 1003708-24-4
Molecular Formula: C6H2BrF2NO2
Molecular Weight: 237.9864
MDL Number: MFCD09839215
SMILES: [O-][N+](=O)c1ccc(c(c1F)F)Br

 

Computed Properties
Complexity: 187  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 12  
Hydrogen Bond Acceptor Count: 4  
XLogP3: 2.6  

 

 

Upstream Synthesis Route
  • 2,3-Difluoro-4-bromonitrobenzene is a versatile chemical compound commonly employed in organic synthesis due to its unique reactivity and properties. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, 2,3-Difluoro-4-bromonitrobenzene can be utilized as a precursor for the introduction of fluorine and bromine functionalities into more complex molecules. Its strategic placement of fluorine and bromine atoms on the aromatic ring enables the synthesis of novel compounds with enhanced biological activities or specific physicochemical properties. Additionally, the nitro group present in this compound can participate in various organic reactions, such as reduction or substitution, leading to diverse molecular transformations. The incorporation of 2,3-Difluoro-4-bromonitrobenzene in chemical synthesis allows researchers to access a wide range of functionalized benzene derivatives, opening up possibilities for the development of advanced materials and therapeutic agents.
FEATURED PRODUCTS