AA02170
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $19.00 | $13.00 | - + | |
1g | 95% | in stock | $22.00 | $16.00 | - + | |
5g | 95% | in stock | $54.00 | $38.00 | - + | |
10g | 95% | in stock | $108.00 | $76.00 | - + | |
25g | 95% | in stock | $270.00 | $189.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02170 |
Chemical Name: | N-Boc-cis-2,6-diethyl-4-piperidone |
CAS Number: | 1003843-30-8 |
Molecular Formula: | C14H25NO3 |
Molecular Weight: | 255.3532 |
MDL Number: | MFCD12406890 |
SMILES: | CC[C@@H]1CC(=O)C[C@@H](N1C(=O)OC(C)(C)C)CC |
Complexity: | 304 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.5 |
The (2R,6S)-rel-tert-Butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate is a valuable compound frequently employed in chemical synthesis for its versatility in building complex molecular structures. This compound serves as a key intermediate in organic reactions, allowing for the introduction of specific functional groups and stereochemical configurations in the final products. Its strategic placement within synthesis pathways enables the efficient creation of diverse compounds with tailored properties and characteristics. By utilizing (2R,6S)-rel-tert-Butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate, chemists can access a wide array of structurally intricate molecules essential for various applications in pharmaceuticals, materials science, and other industries.