logo
Home  > (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride

AA02194

1003872-58-9 | (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% in stock $189.00 $132.00 -   +
250mg 95% in stock $472.00 $330.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA02194
Chemical Name: (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride
CAS Number: 1003872-58-9
Molecular Formula: C12H20ClNO2
Molecular Weight: 245.7457
MDL Number: MFCD18071515
SMILES: COC(=O)C12CC3C[C@@H](C2)C(C(C1)C3)N.Cl

 

Upstream Synthesis Route 
  • The (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride is a versatile compound used in chemical synthesis for its unique structural properties. This compound serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its chiral nature allows for precise control over stereochemistry in synthesis, making it ideal for the production of enantiomerically pure compounds. Additionally, the presence of the methyl and amino groups in the molecule provides opportunities for further functionalization and derivatization to tailor its properties for specific applications. Overall, (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride plays a crucial role in enabling the synthesis of complex molecules with high efficiency and precision.
FEATURED PRODUCTS