logo
Home  > 3-Amino-3-(1-naphthyl)propanoic acid

AA02220

100393-41-7 | 3-Amino-3-(1-naphthyl)propanoic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $65.00 $45.00 -   +
250mg 95% in stock $96.00 $68.00 -   +
500mg 95% in stock $155.00 $109.00 -   +
1g 95% in stock $224.00 $157.00 -   +
5g 95% in stock $1,012.00 $709.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA02220
Chemical Name: 3-Amino-3-(1-naphthyl)propanoic acid
CAS Number: 100393-41-7
Molecular Formula: C13H13NO2
Molecular Weight: 215.2478
MDL Number: MFCD00269725
SMILES: OC(=O)CC(c1cccc2c1cccc2)N

 

Upstream Synthesis Route 
  • 3-Amino-3-(naphthalen-1-yl)propanoic acid is a versatile compound widely used in chemical synthesis. One key application of this compound is as a building block in the synthesis of peptides and pharmaceuticals. Due to its unique structure and reactivity, this compound serves as a valuable intermediate in the preparation of various bioactive molecules. Additionally, its naphthalene moiety can impart specific properties to the final products, making it a crucial component in drug discovery and development. Furthermore, 3-Amino-3-(naphthalen-1-yl)propanoic acid plays a significant role in research and development efforts aimed at designing novel molecules with potential therapeutic applications.
FEATURED PRODUCTS