AA02367
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $48.00 | $34.00 | - + | |
5mg | 97% | in stock | $195.00 | $136.00 | - + | |
10mg | 97% | in stock | $308.00 | $216.00 | - + | |
100mg | 97% | in stock | $713.00 | $499.00 | - + | |
250mg | 97% | in stock | $1,179.00 | $825.00 | - + | |
1g | 97% | in stock | $2,578.00 | $1,805.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02367 |
Chemical Name: | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[(2S)-2-{[methyl({[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl})carbamoyl]amino}-4-(morpholin-4-yl)butanamido]-1,6-diphenylhexan-2-yl]carbamate |
CAS Number: | 1004316-88-4 |
Molecular Formula: | C40H53N7O5S2 |
Molecular Weight: | 776.0227 |
MDL Number: | MFCD18251449 |
SMILES: | O=C(N[C@@H](Cc1ccccc1)CC[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)N(Cc1csc(n1)C(C)C)C)CCN1CCOCC1)OCc1cncs1 |
Complexity: | 1120 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 54 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 20 |
XLogP3: | 5.7 |
2,7,10,12-Tetraazatridecanoic acid, 12-methyl-13-[2-(1-methylethyl)-4-thiazolyl]-9-[2-(4-morpholinyl)ethyl]-8,11-dioxo-3,6-bis(phenylmethyl)-, 5-thiazolylmethyl ester, (3R,6R,9S)- is a complex compound that plays a crucial role in chemical synthesis processes. This compound is commonly utilized in the creation of intricate molecular structures due to its unique combination of functional groups and stereochemistry. Its specific arrangement of atoms allows for precise manipulation and control of chemical reactions, making it a valuable tool in the synthesis of various organic molecules with specific properties and functions.
Clinical pharmacokinetics 20141001
Antimicrobial agents and chemotherapy 20121001
Journal of acquired immune deficiency syndromes (1999) 20120901
Expert opinion on pharmacotherapy 20120901
Deutsche medizinische Wochenschrift (1946) 20120801
Lancet (London, England) 20120630
Lancet (London, England) 20120630
AIDS (London, England) 20110924
AIDS (London, England) 20110327
Journal of acquired immune deficiency syndromes (1999) 20101101
ACS medicinal chemistry letters 20100812
Clinical pharmacology and therapeutics 20100301