AA02373
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $15.00 | $11.00 | - + | |
5g | 95% | in stock | $25.00 | $17.00 | - + | |
25g | 95% | in stock | $59.00 | $41.00 | - + | |
100g | 95% | in stock | $193.00 | $135.00 | - + | |
500g | 95% | in stock | $665.00 | $466.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02373 |
Chemical Name: | 2,N-Dimethyl-n-(3,3-diphenylpropyl)-1-amino-2-propanol |
CAS Number: | 100442-33-9 |
Molecular Formula: | C20H27NO |
Molecular Weight: | 297.4345 |
MDL Number: | MFCD07782118 |
SMILES: | CN(CC(O)(C)C)CCC(c1ccccc1)c1ccccc1 |
Complexity: | 285 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 4 |
The compound 1-(3,3-Diphenyl-N-methylpropylamino)-2-methyl-2-propanol serves as a versatile tool in chemical synthesis, particularly in the field of organic chemistry. Its unique structure and properties make it a valuable reagent for various reactions and transformations. With its combination of a tertiary amine group and a secondary alcohol moiety, this compound can act as a chiral auxiliary in asymmetric synthesis, enabling the creation of stereochemically pure compounds. Additionally, its steric hindrance and substituent groups make it a suitable ligand for catalytic processes, facilitating complex bond formations and selective reactions. Moreover, the presence of both basic and acidic functional groups in this compound allows for diverse manipulations in chemical reactions, such as in Lewis acid-catalyzed processes or acid-base mediated transformations. Overall, 1-(3,3-Diphenyl-N-methylpropylamino)-2-methyl-2-propanol is a valuable tool in chemical synthesis, offering a range of possibilities for the efficient and selective formation of complex organic molecules.