AA02440
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $297.00 | $208.00 | - + | |
10g | 98% | in stock | $448.00 | $314.00 | - + | |
25g | 98% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02440 |
Chemical Name: | 1-BOC 7-Chloroindole |
CAS Number: | 1004558-41-1 |
Molecular Formula: | C13H14ClNO2 |
Molecular Weight: | 251.7088 |
MDL Number: | MFCD13183456 |
SMILES: | Clc1cccc2c1n(cc2)C(=O)OC(C)(C)C |
Complexity: | 300 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.9 |
The tert-Butyl 7-chloro-1H-indole-1-carboxylate is a versatile compound widely used in chemical synthesis processes. It serves as a crucial building block in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound exhibits unique reactivity and acts as an essential intermediate in the synthesis of complex organic molecules. Its strategic incorporation in synthetic routes enables the introduction of specific functional groups and structural motifs, facilitating the creation of diverse chemical entities. In particular, the tert-Butyl 7-chloro-1H-indole-1-carboxylate plays a significant role in the development of advanced materials and innovative drug candidates, showcasing its indispensable utility in modern organic synthesis strategies.