AA02487
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $45.00 | $31.00 | - + | |
250mg | 95% | in stock | $67.00 | $47.00 | - + | |
1g | 95% | in stock | $92.00 | $64.00 | - + | |
5g | 95% | in stock | $355.00 | $248.00 | - + | |
25g | 95% | in stock | $1,761.00 | $1,233.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02487 |
Chemical Name: | 4-Amino-3,5-dimethylphenylboronic acid, pinacol ester |
CAS Number: | 1004761-68-5 |
Molecular Formula: | C14H22BNO2 |
Molecular Weight: | 247.141 |
MDL Number: | MFCD18837628 |
SMILES: | CC1(C)OB(OC1(C)C)c1cc(C)c(c(c1)C)N |
Complexity: | 291 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
The compound 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is a versatile and valuable building block in chemical synthesis. It is commonly used as a key reagent in organic reactions, particularly in the field of medicinal and materials chemistry.This compound is known for its unique structure, which allows it to participate in a variety of important transformations. One of its primary applications is as a ligand in transition metal-catalyzed coupling reactions, such as Suzuki-Miyaura cross-coupling. In this process, the aniline moiety serves as an important directing group, enabling the selective formation of new carbon-carbon bonds.Furthermore, the boron-containing group attached to the aniline scaffold can undergo various transformations, making it a valuable handle for further functionalization. This feature enables chemists to introduce a wide range of substituents, allowing for the tailored synthesis of complex molecules.Overall, the compound 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline plays a crucial role in modern chemical synthesis, facilitating the efficient construction of diverse organic structures with applications in drug discovery, materials science, and beyond.