AA02486
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $35.00 | $25.00 | - + | |
1g | 98% | in stock | $69.00 | $49.00 | - + | |
5g | 98% | in stock | $297.00 | $208.00 | - + | |
10g | 98% | in stock | $448.00 | $314.00 | - + | |
25g | 98% | in stock | $758.00 | $531.00 | - + | |
100g | 98% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02486 |
Chemical Name: | 3-Methoxy-4-(trifluoromethyl)phenylboronic acid |
CAS Number: | 1004775-33-0 |
Molecular Formula: | C8H8BF3O3 |
Molecular Weight: | 219.9535 |
MDL Number: | MFCD13194426 |
SMILES: | COc1cc(ccc1C(F)(F)F)B(O)O |
Complexity: | 210 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
(3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis. This boronic acid derivative serves as a valuable building block in organic synthesis, particularly in the field of medicinal chemistry and material science.In chemical synthesis, (3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid is commonly employed as a key reagent for Suzuki-Miyaura cross-coupling reactions. This reaction, catalyzed by palladium, enables the formation of carbon-carbon bonds between an aryl or vinyl boronic acid derivative and an organic halide or pseudohalide. The high reactivity and selectivity of (3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid make it a valuable tool for the construction of complex organic molecules with diverse functionalities.Furthermore, the trifluoromethyl group on the phenyl ring imparts unique properties to the resulting molecules, making them valuable in pharmaceutical research and agrochemical development. The presence of the methoxy group allows for further functionalization and modification of the compound, expanding its utility in various synthetic pathways.Overall, (3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid plays a crucial role in modern chemical synthesis, enabling the efficient and selective construction of novel compounds with potential applications in drug discovery, material science, and beyond.