AI04923
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $16.00 | $12.00 | - + | |
25g | 97% | in stock | $59.00 | $41.00 | - + | |
100g | 97% | in stock | $173.00 | $121.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI04923 |
Chemical Name: | Ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate |
CAS Number: | 100491-29-0 |
Molecular Formula: | C17H10ClF3N2O3 |
Molecular Weight: | 382.7211 |
MDL Number: | MFCD01863285 |
SMILES: | CCOC(=O)c1cn(c2ccc(cc2F)F)c2c(c1=O)cc(c(n2)Cl)F |
Complexity: | 606 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 4 |
XLogP3: | 4 |
Ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate is a versatile compound commonly used in chemical synthesis due to its unique structure and reactivity. In organic synthesis, this compound serves as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and functional materials. Its presence in a reaction mixture can lead to the formation of complex molecular frameworks with potential biological activities. The substitution pattern on the naphthyridine core provides opportunities for further derivatization, allowing chemists to tailor the properties of the final products. Whether employed in traditional chemical transformations or more advanced synthetic methodologies, Ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate plays a crucial role in expanding the synthetic toolbox for creating diverse molecular structures.