AA02608
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $24.00 | $17.00 | - + | |
250mg | 97% | in stock | $30.00 | $21.00 | - + | |
1g | 97% | in stock | $110.00 | $77.00 | - + | |
5g | 97% | in stock | $415.00 | $291.00 | - + | |
25g | 97% | in stock | $2,025.00 | $1,418.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02608 |
Chemical Name: | 6-(Methylamino)-3-pyridinyl boronic acid pinacol ester |
CAS Number: | 1005009-98-2 |
Molecular Formula: | C12H19BN2O2 |
Molecular Weight: | 234.1025 |
MDL Number: | MFCD11878220 |
SMILES: | CNc1ccc(cn1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
N-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine is a versatile compound widely used in chemical synthesis as a key building block in the formation of complex organic molecules. Its unique structure containing a boronate ester moiety makes it highly valuable for various synthetic applications. This compound is frequently employed in cross-coupling reactions, such as Suzuki-Miyaura coupling, to facilitate the construction of carbon-carbon bonds. Additionally, the presence of the pyridine and amine functionalities enhances its reactivity and allows for further functionalization through various transformations. Its strategic incorporation in synthesis strategies enables the rapid and efficient access to diverse chemical entities with potential applications in pharmaceuticals, agrochemicals, materials science, and other fields requiring advanced synthetic methodologies.