logo
Home  > Diethyl ([(2,3,4-trifluorophenyl)amino]methylene)malonate

AE55857

100501-60-8 | Diethyl ([(2,3,4-trifluorophenyl)amino]methylene)malonate

Packsize Purity Availability Price Discounted Price    Quantity
500mg 95% 2 weeks $548.00 $384.00 -   +
1g 95% 2 weeks $578.00 $405.00 -   +
5g 95% 2 weeks $885.00 $620.00 -   +
10g 95% 2 weeks $1,262.00 $884.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE55857
Chemical Name: Diethyl ([(2,3,4-trifluorophenyl)amino]methylene)malonate
CAS Number: 100501-60-8
Molecular Formula: C14H14F3NO4
Molecular Weight: 317.2605
MDL Number: MFCD00796044
SMILES: CCOC(=O)C(=CNc1ccc(c(c1F)F)F)C(=O)OCC

 

Upstream Synthesis Route 
  • 1,3-Diethyl 2-[[(2,3,4-trifluorophenyl)amino]methylene]propanedioate is a versatile compound widely used in chemical synthesis for its ability to act as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for the efficient formation of complex molecules through a series of well-defined chemical reactions. This compound serves as a crucial building block in the creation of advanced materials and bioactive compounds, making it an indispensable tool in modern organic chemistry research.
FEATURED PRODUCTS