logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Quinolines  > Ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate

AA02611

100501-62-0 | Ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $31.00 $22.00 -   +
5g 98% in stock $60.00 $42.00 -   +
25g 98% in stock $183.00 $128.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA02611
Chemical Name: Ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate
CAS Number: 100501-62-0
Molecular Formula: C14H12F3NO3
Molecular Weight: 299.2452
MDL Number: MFCD00276022
SMILES: CCOC(=O)c1cn(CC)c2c(c1=O)cc(c(c2F)F)F

 

Computed Properties
Complexity: 468  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 21  
Hydrogen Bond Acceptor Count: 7  
Rotatable Bond Count: 4  
XLogP3: 1.9  

 

 

Upstream Synthesis Route
  • Ethyl 1-ethyl-6,7,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate is a versatile compound commonly used in chemical synthesis procedures. Its unique structure and properties make it a valuable reagent in various synthetic reactions.One important application of Ethyl 1-ethyl-6,7,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate is its role as a key intermediate in the synthesis of pharmaceutical compounds. The presence of the trifluoro group and the oxo moiety in the molecule enables this compound to participate in diverse reactions, leading to the formation of structurally complex molecules with potential biological activity.In addition, Ethyl 1-ethyl-6,7,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate can be employed as a building block for the construction of heterocyclic frameworks. Its ability to undergo various transformations, such as functional group manipulations and cyclization reactions, opens up opportunities for the preparation of novel compounds with desired properties.Overall, the strategic incorporation of Ethyl 1-ethyl-6,7,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate in chemical synthesis endeavors allows for the efficient and tailored production of complex molecules with potential applications in drug discovery, material science, and other fields.
FEATURED PRODUCTS