AA02665
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $42.00 | $30.00 | - + | |
1g | 95% | in stock | $52.00 | $37.00 | - + | |
5g | 95% | in stock | $133.00 | $94.00 | - + | |
10g | 95% | in stock | $259.00 | $181.00 | - + | |
100g | 95% | in stock | $2,313.00 | $1,619.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA02665 |
Chemical Name: | Benzyl (2R,3S)-(-)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate |
CAS Number: | 100516-54-9 |
Molecular Formula: | C24H21NO4 |
Molecular Weight: | 387.4278 |
MDL Number: | MFCD00074958 |
SMILES: | O=C1O[C@H](c2ccccc2)[C@@H](N(C1)C(=O)OCc1ccccc1)c1ccccc1 |
Complexity: | 547 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.4 |
In chemical synthesis, (2R,3S)-Benzyl 6-oxo-2,3-diphenylmorpholine-4-carboxylate plays a crucial role as a versatile building block. This compound can be utilized as a key intermediate in the preparation of various complex molecules through organic reactions. Due to its unique structure and functional groups, (2R,3S)-Benzyl 6-oxo-2,3-diphenylmorpholine-4-carboxylate serves as a valuable starting material for the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its presence enables the introduction of specific substituents and stereochemistry in target molecules, allowing chemists to fine-tune the properties and activities of the final products.