logo
Home  > 2-[(4-Nitrobenzyl)thio]-1H-benzimidazole

AV79660

100541-50-2 | 2-[(4-Nitrobenzyl)thio]-1H-benzimidazole

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% 1 week $205.00 $143.00 -   +
250mg 95% 1 week $280.00 $196.00 -   +
1g 95% 1 week $759.00 $531.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AV79660
Chemical Name: 2-[(4-Nitrobenzyl)thio]-1H-benzimidazole
CAS Number: 100541-50-2
Molecular Formula: C14H11N3O2S
Molecular Weight: 285.321
MDL Number: MFCD00422158
SMILES: [O-][N+](=O)c1ccc(cc1)CSc1nc2c([nH]1)cccc2

 

Upstream Synthesis Route 
  • 2-[(4-nitrobenzyl)thio]-1H-benzimidazole is a versatile compound widely used in chemical synthesis as a key building block. Its unique structure and functional groups make it a valuable reagent in organic chemistry reactions. This compound plays a crucial role in synthetic methodologies for creating diverse molecules such as pharmaceuticals, agrochemicals, and materials. Specifically, 2-[(4-nitrobenzyl)thio]-1H-benzimidazole is commonly employed as a precursor for the synthesis of complex heterocyclic compounds with potential biological activities. Its reactivity and compatibility with various synthetic strategies make it a valuable tool for designing and constructing novel molecules with tailored properties. This compound's utility extends to the development of innovative synthetic routes and strategies for the efficient production of target molecules with enhanced functional properties in drug discovery and material science.
FEATURED PRODUCTS