logo
Home  > Sodium bis(fluorosulfonyl)imide

AE17151

100669-96-3 | Sodium bis(fluorosulfonyl)imide

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $33.00 $23.00 -   +
5g 95% in stock $40.00 $28.00 -   +
10g 95% in stock $72.00 $51.00 -   +
25g 95% in stock $152.00 $107.00 -   +
100g 95% in stock $607.00 $425.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE17151
Chemical Name: Sodium bis(fluorosulfonyl)imide
CAS Number: 100669-96-3
Molecular Formula: F2NNaO4S2
Molecular Weight: 203.12087640000001
MDL Number: MFCD29905041
SMILES: FS(=O)(=O)[N-]S(=O)(=O)F.[Na+]

 

Computed Properties
Complexity: 235  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 10  
Hydrogen Bond Acceptor Count: 7  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route
  • Sodium bis(fluorosulfonyl)imide, also known as NaFSI, is a versatile and powerful reagent used in chemical synthesis. Its unique properties make it particularly well-suited for applications in various organic transformations. One of the key roles of NaFSI in chemical synthesis is as a powerful fluorine source. Its high fluorine content allows for efficient fluorination reactions, which are invaluable in the pharmaceutical and agrochemical industries for the synthesis of fluorinated compounds. Additionally, NaFSI is often employed as an electrolyte in high-performance batteries, where its high ionic conductivity and stability contribute to enhanced battery performance. In summary, Sodium bis(fluorosulfonyl)imide plays a crucial role in facilitating a wide range of chemical reactions and applications in the field of synthetic chemistry.
FEATURED PRODUCTS