AE17151
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $40.00 | $28.00 | - + | |
10g | 95% | in stock | $72.00 | $51.00 | - + | |
25g | 95% | in stock | $152.00 | $107.00 | - + | |
100g | 95% | in stock | $607.00 | $425.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE17151 |
Chemical Name: | Sodium bis(fluorosulfonyl)imide |
CAS Number: | 100669-96-3 |
Molecular Formula: | F2NNaO4S2 |
Molecular Weight: | 203.12087640000001 |
MDL Number: | MFCD29905041 |
SMILES: | FS(=O)(=O)[N-]S(=O)(=O)F.[Na+] |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 2 |
Sodium bis(fluorosulfonyl)imide, also known as NaFSI, is a versatile and powerful reagent used in chemical synthesis. Its unique properties make it particularly well-suited for applications in various organic transformations. One of the key roles of NaFSI in chemical synthesis is as a powerful fluorine source. Its high fluorine content allows for efficient fluorination reactions, which are invaluable in the pharmaceutical and agrochemical industries for the synthesis of fluorinated compounds. Additionally, NaFSI is often employed as an electrolyte in high-performance batteries, where its high ionic conductivity and stability contribute to enhanced battery performance. In summary, Sodium bis(fluorosulfonyl)imide plays a crucial role in facilitating a wide range of chemical reactions and applications in the field of synthetic chemistry.