AA03211
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $34.00 | $24.00 | - + | |
1g | 97% | in stock | $99.00 | $70.00 | - + | |
25g | 97% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03211 |
Chemical Name: | tert-butyl 2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate |
CAS Number: | 1006875-83-7 |
Molecular Formula: | C15H25BN2O4 |
Molecular Weight: | 308.181 |
MDL Number: | MFCD22570725 |
SMILES: | O=C(OC(C)(C)C)Cn1ncc(c1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 418 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
With its unique molecular structure, tert-Butyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate serves as a valuable reagent in chemical synthesis processes. This compound is commonly used as a versatile building block in the preparation of various organic compounds. Its incorporation into synthetic pathways often facilitates the introduction of functional groups or structural motifs that are crucial for the development of complex molecules. Additionally, tert-Butyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate can enable selective modifications at specific sites within a molecule, thereby allowing chemists to fine-tune the properties of the final product. In the realm of chemical synthesis, this compound's reactivity and compatibility with diverse reaction conditions make it a valuable tool for the construction of novel compounds with potential applications in various fields.