logo
Home  > L-Histidine hydrochloride

AA03274

1007-42-7 | L-Histidine hydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
10g 97% in stock $11.00 $8.00 -   +
25g 97% in stock $14.00 $10.00 -   +
100g 97% in stock $25.00 $18.00 -   +
500g 97% in stock $67.00 $47.00 -   +
1000g 97% in stock $109.00 $77.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA03274
Chemical Name: L-Histidine hydrochloride
CAS Number: 1007-42-7
Molecular Formula: C6H10ClN3O2
Molecular Weight: 191.6155
MDL Number: MFCD00066569
SMILES: N[C@H](C(=O)O)Cc1c[nH]cn1.Cl

 

Computed Properties
Complexity: 151  
Covalently-Bonded Unit Count: 2  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 12  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 4  
Rotatable Bond Count: 3  

 

 

Upstream Synthesis Route
  • L-Histidine hydrochloride is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. In organic chemistry, L-Histidine hydrochloride serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo selective functional group transformations makes it a valuable tool in the development of new molecules with tailored properties. Additionally, L-Histidine hydrochloride can act as a chiral auxiliary, enabling the synthesis of enantiomerically pure compounds. Its presence in the synthesis process can lead to improved selectivity and enhanced overall efficiency. This compound plays a crucial role in the creation of diverse chemical structures and is a valuable asset in the toolkit of synthetic chemists.
FEATURED PRODUCTS