logo
Home  > TrimeprazineSulfoxide

AX54413

10071-07-5 | TrimeprazineSulfoxide

Packsize Purity Availability Price Discounted Price    Quantity
10mg 3 weeks $418.00 $292.00 -   +
50mg 3 weeks $1,199.00 $840.00 -   +
250mg 3 weeks $2,074.00 $1,452.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX54413
Chemical Name: TrimeprazineSulfoxide
CAS Number: 10071-07-5
Molecular Formula: C18H22N2OS
Molecular Weight: 314.4451
SMILES: CN(CC(CN1c2ccccc2S(=O)c2c1cccc2)C)C

 

Upstream Synthesis Route
  • Trimeprazine Sulfoxide is a versatile compound commonly used in chemical synthesis for its unique properties and reactivity. Its application in organic chemistry primarily revolves around its role as a potent oxidation agent and a valuable intermediate in various synthetic pathways.As an efficient oxidizing agent, Trimeprazine Sulfoxide is frequently employed in the conversion of sulfides to sulfoxides and sulfones. This oxidative capability allows for the modification of sulfur-containing functional groups in organic molecules, enabling the synthesis of diverse compounds with desired properties. Moreover, its selective oxidation reactions make it an essential reagent in the preparation of pharmaceuticals, agrochemicals, and fine chemicals.In addition to its role as an oxidant, Trimeprazine Sulfoxide serves as a key building block in the construction of complex molecular structures. Its reactivity towards nucleophiles and electrophiles makes it a valuable intermediate for the formation of carbon-sulfur bonds, which are pivotal in the synthesis of bioactive molecules and heterocyclic compounds. By incorporating Trimeprazine Sulfoxide into chemical reactions, chemists can access a wide range of structural motifs that are crucial for drug discovery and material science applications.Overall, Trimeprazine Sulfoxide's importance in chemical synthesis lies in its ability to facilitate oxidation reactions, functionalize sulfur-containing compounds, and serve as a versatile precursor for the preparation of valuable organic molecules. Its unique reactivity and utility make it a valuable tool for synthetic chemists seeking to access diverse chemical space and develop novel compounds for various applications.
FEATURED PRODUCTS