AA03275
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $73.00 | $51.00 | - + | |
250mg | 98% | in stock | $122.00 | $85.00 | - + | |
1g | 98% | in stock | $340.00 | $238.00 | - + | |
5g | 98% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03275 |
Chemical Name: | 4-(N,N-Dimethylamino)naphthalen-1-boronic acid, pinacol ester |
CAS Number: | 1007126-41-1 |
Molecular Formula: | C18H24BNO2 |
Molecular Weight: | 297.19966 |
MDL Number: | MFCD18087705 |
SMILES: | CN(c1ccc(c2c1cccc2)B1OC(C(O1)(C)C)(C)C)C |
Complexity: | 394 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine, commonly known as $name$, serves as a versatile reagent in chemical synthesis. This compound is particularly valued for its efficacy in Suzuki-Miyaura cross-coupling reactions. By acting as a boron source, $name$ facilitates the formation of carbon-carbon bonds, enabling the synthesis of complex organic molecules. Additionally, its dimethylamine functionality enhances its reactivity and selectivity in various transformations, making it a valuable tool in the construction of organic frameworks with high precision and efficiency.