AA03307
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $43.00 | $30.00 | - + | |
1g | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $297.00 | $208.00 | - + | |
10g | 98% | in stock | $510.00 | $357.00 | - + | |
25g | 98% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03307 |
Chemical Name: | 3-Benzyloxy-4-chlorophenylboronic acid |
CAS Number: | 1007170-24-2 |
Molecular Formula: | C13H12BClO3 |
Molecular Weight: | 262.4966 |
MDL Number: | MFCD08701723 |
SMILES: | OB(c1ccc(c(c1)OCc1ccccc1)Cl)O |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
($Name$) is a highly versatile and valuable compound in chemical synthesis due to its unique properties and wide range of applications. One of the key uses of (3-(Benzyloxy)-4-chlorophenyl)boronic acid is as a building block in the synthesis of various organic molecules and pharmaceuticals. This compound acts as a key intermediate in Suzuki-Miyaura cross-coupling reactions, allowing for the efficient construction of carbon-carbon bonds.In the field of medicinal chemistry, (3-(Benzyloxy)-4-chlorophenyl)boronic acid has been utilized in the synthesis of potential drug candidates targeting various diseases and biological pathways. Its boronic acid functionality allows for selective interactions with specific biomolecular targets, making it a valuable tool in drug discovery and development.Furthermore, this compound can be employed in the construction of complex molecules through sequential functional group transformations, enabling the synthesis of diverse chemical entities with tailored properties. Its compatibility with a wide range of functional groups and reaction conditions makes it a valuable asset in the toolbox of synthetic chemists.Overall, (3-(Benzyloxy)-4-chlorophenyl)boronic acid plays a crucial role in modern organic synthesis by enabling the efficient and selective construction of complex molecules with diverse applications in medicinal chemistry, materials science, and beyond.